C12H16N6 — CID 137108888
cis-(1S,3R)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentan-1-amine (PubChem CID 137108888) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is cis-(1S,3R)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 137108888 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | cis-(1S,3R)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentan-1-amine |
| SMILES | [H]/N=C(\[C@@H]1CC[C@H](N)C1)n1/c(=N/[H])cnc2[nH]ccc21 |
| InChI | InChI=1S/C12H16N6/c13-8-2-1-7(5-8)11(15)18-9-3-4-16-12(9)17-6-10(18)14/h3-4,6-8,14-16H,1-2,5,13H2/b14-10+,15-11+/t7-,8+/m1/s1 |
| InChIKey | UAAXCEYOCYDNHW-XCGGLCRRSA-N |
| XLogP | 0.80 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|