About 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one
8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one (PubChem CID 137108981) has the molecular formula C19H12F3N3OS
and a molecular weight of 387.39 g/mol. Its IUPAC name is 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
| PubChem CID | 137108981 |
| Molecular Formula | C19H12F3N3OS |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
| SMILES | Cc1cccc2c(=O)[nH]c(-c3cc(-c4cncs4)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C19H12F3N3OS/c1-10-3-2-4-14-16(10)24-17(25-18(14)26)12-5-11(15-8-23-9-27-15)6-13(7-12)19(20,21)22/h2-9H,1H3,(H,24,25,26) |
| InChIKey | HSOVTNSGAVLLFR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one?
The IUPAC name of 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one (CID 137108981) is 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one.
What is the SMILES notation for 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one?
The canonical SMILES for 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one is Cc1cccc2c(=O)[nH]c(-c3cc(-c4cncs4)cc(C(F)(F)F)c3)nc12.
What is the InChIKey of 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one?
The InChIKey is HSOVTNSGAVLLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3N3OS/c1-10-3-2-4-14-16(10)24-17(25-18(14)26)12-5-11(15-8-23-9-27-15)6-13(7-12)19(20,21)22/h2-9H,1H3,(H,24,25,26).
What are the key properties of 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one?
8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one has a molecular weight of 387.39 g/mol, XLogP of 5.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2-[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]-3H-quinazolin-4-one is sourced from PubChem (CID 137108981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).