C28H23N5OS — CID 137115746
N-[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]butanamide (PubChem CID 137115746) has the molecular formula C28H23N5OS and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]butanamide.
| Compound Name | N-[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 137115746 |
| Molecular Formula | C28H23N5OS |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]butanamide |
| SMILES | CCCC(=O)Nc1cncc(-c2ccc3[nH]nc(-c4cc5c(-c6cccs6)cccc5[nH]4)c3c2)c1 |
| InChI | InChI=1S/C28H23N5OS/c1-2-5-27(34)30-19-12-18(15-29-16-19)17-9-10-24-22(13-17)28(33-32-24)25-14-21-20(26-8-4-11-35-26)6-3-7-23(21)31-25/h3-4,6-16,31H,2,5H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | YVDCTJGBJVBKHA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |