C30H27N5OS — CID 137117821
N-[3-ethyl-5-[3-(4-thiophen-3-yl-1H-benzimidazol-2-yl)-1H-indazol-5-yl]phenyl]butanamide (PubChem CID 137117821) has the molecular formula C30H27N5OS and a molecular weight of 505.65 g/mol. Its IUPAC name is N-[3-ethyl-5-[3-(4-thiophen-3-yl-1H-benzimidazol-2-yl)-1H-indazol-5-yl]phenyl]butanamide.
| Compound Name | N-[3-ethyl-5-[3-(4-thiophen-3-yl-1H-benzimidazol-2-yl)-1H-indazol-5-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 137117821 |
| Molecular Formula | C30H27N5OS |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-[3-ethyl-5-[3-(4-thiophen-3-yl-1H-benzimidazol-2-yl)-1H-indazol-5-yl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cc(CC)cc(-c2ccc3[nH]nc(-c4nc5c(-c6ccsc6)cccc5[nH]4)c3c2)c1 |
| InChI | InChI=1S/C30H27N5OS/c1-3-6-27(36)31-22-14-18(4-2)13-21(15-22)19-9-10-25-24(16-19)29(35-34-25)30-32-26-8-5-7-23(28(26)33-30)20-11-12-37-17-20/h5,7-17H,3-4,6H2,1-2H3,(H,31,36)(H,32,33)(H,34,35) |
| InChIKey | NHHXAONZRKDGKP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |