C17H11ClI2N2O2S — CID 137118906
(5Z)-2-(4-chloro-2-methylphenyl)imino-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137118906) has the molecular formula C17H11ClI2N2O2S and a molecular weight of 596.62 g/mol. Its IUPAC name is (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137118906 |
| Molecular Formula | C17H11ClI2N2O2S |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 595.83 |
| IUPAC Name | (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(Cl)ccc1/N=C1\NC(=O)/C(=C/c2cc(I)c(O)c(I)c2)S1 |
| InChI | InChI=1S/C17H11ClI2N2O2S/c1-8-4-10(18)2-3-13(8)21-17-22-16(24)14(25-17)7-9-5-11(19)15(23)12(20)6-9/h2-7,23H,1H3,(H,21,22,24)/b14-7- |
| InChIKey | JCQXQEVOKSKBHV-AUWJEWJLSA-N |
| XLogP | 5.45 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|