About N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine
N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine (PubChem CID 137119418) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine.
Molecular Properties
| Compound Name | N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine |
| PubChem CID | 137119418 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine |
| SMILES | CC/N=C1\NC=NC2C=CC#CC12 |
| InChI | InChI=1S/C10H11N3/c1-2-11-10-8-5-3-4-6-9(8)12-7-13-10/h4,6-9H,2H2,1H3,(H,11,12,13) |
| InChIKey | TWZPVROVEUQKJM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine?
The IUPAC name of N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine (CID 137119418) is N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine.
What is the SMILES notation for N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine?
The canonical SMILES for N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine is CC/N=C1\NC=NC2C=CC#CC12.
What is the InChIKey of N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine?
The InChIKey is TWZPVROVEUQKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-2-11-10-8-5-3-4-6-9(8)12-7-13-10/h4,6-9H,2H2,1H3,(H,11,12,13).
What are the key properties of N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine?
N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine has a molecular weight of 173.22 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5,6-didehydro-4a,8a-dihydro-3H-quinazolin-4-imine is sourced from PubChem (CID 137119418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).