C27H32N6O2S — CID 137119435
1,3-bis[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]thiourea (PubChem CID 137119435) has the molecular formula C27H32N6O2S and a molecular weight of 504.66 g/mol. Its IUPAC name is 1,3-bis[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]thiourea.
| Compound Name | 1,3-bis[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 137119435 |
| Molecular Formula | C27H32N6O2S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 1,3-bis[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylideneamino]thiourea |
| SMILES | Oc1c(C=NNC(=S)NN=Cc2cc3c4c(c2O)CCCN4CCC3)cc2c3c1CCCN3CCC2 |
| InChI | InChI=1S/C27H32N6O2S/c34-25-19(13-17-5-1-9-32-11-3-7-21(25)23(17)32)15-28-30-27(36)31-29-16-20-14-18-6-2-10-33-12-4-8-22(24(18)33)26(20)35/h13-16,34-35H,1-12H2,(H2,30,31,36) |
| InChIKey | VOXATACAHBIJTQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|