C38H47N5O7 — CID 137119436
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[4-[2-(1,2-dihydroxy-4,5,5-trimethylcyclohexyl)ethylcarbamoyl]phenoxy]phenyl]-N-ethyl-1,2,4-triazole-3-carboxamide (PubChem CID 137119436) has the molecular formula C38H47N5O7 and a molecular weight of 685.82 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[4-[2-(1,2-dihydroxy-4,5,5-trimethylcyclohexyl)ethylcarbamoyl]phenoxy]phenyl]-N-ethyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[4-[2-(1,2-dihydroxy-4,5,5-trimethylcyclohexyl)ethylcarbamoyl]phenoxy]phenyl]-N-ethyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 137119436 |
| Molecular Formula | C38H47N5O7 |
| Molecular Weight | 685.82 g/mol |
| Exact Mass | 685.35 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[4-[2-(1,2-dihydroxy-4,5,5-trimethylcyclohexyl)ethylcarbamoyl]phenoxy]phenyl]-N-ethyl-1,2,4-triazole-3-carboxamide |
| SMILES | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(Oc2ccc(C(=O)NCCC3(O)CC(C)(C)C(C)CC3O)cc2)cc1 |
| InChI | InChI=1S/C38H47N5O7/c1-7-39-36(48)34-42-41-33(29-19-28(22(2)3)30(44)20-31(29)45)43(34)25-10-14-27(15-11-25)50-26-12-8-24(9-13-26)35(47)40-17-16-38(49)21-37(5,6)23(4)18-32(38)46/h8-15,19-20,22-23,32,44-46,49H,7,16-18,21H2,1-6H3,(H,39,48)(H,40,47) |
| InChIKey | UWFWWNYKTYDMSX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.82 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |