C20H16N4O4S — CID 137119525
4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide (PubChem CID 137119525) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 137119525 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(-c3ccccc3O)nc2-c2ccccc2O)cc1 |
| InChI | InChI=1S/C20H16N4O4S/c21-29(27,28)14-11-9-13(10-12-14)24-20(16-6-2-4-8-18(16)26)22-19(23-24)15-5-1-3-7-17(15)25/h1-12,25-26H,(H2,21,27,28) |
| InChIKey | BYRYHMHOVAQOOO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |