C35H44N4O7 — CID 137120713
benzyl N-[(2S)-1-[[(2S)-1-[(2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 137120713) has the molecular formula C35H44N4O7 and a molecular weight of 632.76 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-[(2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-[(2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137120713 |
| Molecular Formula | C35H44N4O7 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-[(2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)c1cc(/C=N\NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](CO)NC(=O)OCc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C35H44N4O7/c1-34(2,3)26-16-24(17-27(30(26)42)35(4,5)6)19-36-39-32(44)28(18-22-12-14-25(41)15-13-22)37-31(43)29(20-40)38-33(45)46-21-23-10-8-7-9-11-23/h7-17,19,28-29,40-42H,18,20-21H2,1-6H3,(H,37,43)(H,38,45)(H,39,44)/b36-19-/t28-,29-/m0/s1 |
| InChIKey | IYTXSQQXCAEIBF-ZAIUCNSESA-N |
| XLogP | 4.16 |
| TPSA | 169.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|