C28H23BrINO5S — CID 137121238
ethyl (5Z)-5-[[2-bromo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137121238) has the molecular formula C28H23BrINO5S and a molecular weight of 692.37 g/mol. Its IUPAC name is ethyl (5Z)-5-[[2-bromo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[2-bromo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137121238 |
| Molecular Formula | C28H23BrINO5S |
| Molecular Weight | 692.37 g/mol |
| Exact Mass | 690.95 |
| IUPAC Name | ethyl (5Z)-5-[[2-bromo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(OC)c(OCc3ccc(I)cc3)cc2Br)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C28H23BrINO5S/c1-3-35-28(33)25-26(32)24(37-27(25)31-20-7-5-4-6-8-20)14-18-13-22(34-2)23(15-21(18)29)36-16-17-9-11-19(30)12-10-17/h4-15,32H,3,16H2,1-2H3/b24-14-,31-27- |
| InChIKey | QOIUULPDGBRDTB-HSQGGINXSA-N |
| XLogP | 7.83 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.37 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|