About 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one
2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one (PubChem CID 137121599) has the molecular formula C9H7BrN2O3
and a molecular weight of 271.07 g/mol. Its IUPAC name is 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one |
| PubChem CID | 137121599 |
| Molecular Formula | C9H7BrN2O3 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CBr)nc2c(O)ccc(O)c12 |
| InChI | InChI=1S/C9H7BrN2O3/c10-3-6-11-8-5(14)2-1-4(13)7(8)9(15)12-6/h1-2,13-14H,3H2,(H,11,12,15) |
| InChIKey | XIOXNZACQKFRHH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one?
The IUPAC name of 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one (CID 137121599) is 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one.
What is the SMILES notation for 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one?
The canonical SMILES for 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one is O=c1[nH]c(CBr)nc2c(O)ccc(O)c12.
What is the InChIKey of 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one?
The InChIKey is XIOXNZACQKFRHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O3/c10-3-6-11-8-5(14)2-1-4(13)7(8)9(15)12-6/h1-2,13-14H,3H2,(H,11,12,15).
What are the key properties of 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one?
2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one has a molecular weight of 271.07 g/mol, XLogP of 1.23, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-5,8-dihydroxy-3H-quinazolin-4-one is sourced from PubChem (CID 137121599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).