C17H17FN6OS — CID 137122326
2-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,3,4-thiadiazol-2-yl]-3-fluoro-5-(1H-pyrazol-4-yl)phenol (PubChem CID 137122326) has the molecular formula C17H17FN6OS and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,3,4-thiadiazol-2-yl]-3-fluoro-5-(1H-pyrazol-4-yl)phenol.
| Compound Name | 2-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,3,4-thiadiazol-2-yl]-3-fluoro-5-(1H-pyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 137122326 |
| Molecular Formula | C17H17FN6OS |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,3,4-thiadiazol-2-yl]-3-fluoro-5-(1H-pyrazol-4-yl)phenol |
| SMILES | Oc1cc(-c2cn[nH]c2)cc(F)c1-c1nnc(N2CC3CNCC3C2)s1 |
| InChI | InChI=1S/C17H17FN6OS/c18-13-1-9(10-5-20-21-6-10)2-14(25)15(13)16-22-23-17(26-16)24-7-11-3-19-4-12(11)8-24/h1-2,5-6,11-12,19,25H,3-4,7-8H2,(H,20,21) |
| InChIKey | NWBBUVYUDDBDNC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |