C20H24N4O3 — CID 137122867
3-acetamido-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]benzamide (PubChem CID 137122867) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-acetamido-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]benzamide.
| Compound Name | 3-acetamido-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 137122867 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-acetamido-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)c2cccc(NC(C)=O)c2)c(O)c1 |
| InChI | InChI=1S/C20H24N4O3/c1-4-24(5-2)18-10-9-16(19(26)12-18)13-21-23-20(27)15-7-6-8-17(11-15)22-14(3)25/h6-13,26H,4-5H2,1-3H3,(H,22,25)(H,23,27)/b21-13- |
| InChIKey | WOVLLYUPYFQWRW-BKUYFWCQSA-N |
| XLogP | 2.96 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|