C10H17N3O5S — CID 137123499
[(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl-methylcarbamic acid (PubChem CID 137123499) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl-methylcarbamic acid.
| Compound Name | [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 137123499 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl-methylcarbamic acid |
| SMILES | C/N=C1/N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CN(C)C(=O)O)O[C@@H]2S1 |
| InChI | InChI=1S/C10H17N3O5S/c1-11-9-12-5-7(15)6(14)4(18-8(5)19-9)3-13(2)10(16)17/h4-8,14-15H,3H2,1-2H3,(H,11,12)(H,16,17)/t4-,5-,6-,7-,8-/m1/s1 |
| InChIKey | MVWRAIOFFBTKGZ-FMDGEEDCSA-N |
| XLogP | -1.27 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|