About (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide
(2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide (PubChem CID 137123519) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide.
Molecular Properties
| Compound Name | (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide |
| PubChem CID | 137123519 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(N)=C(\C=C/C)NC=C |
| InChI | InChI=1S/C8H14N4/c1-3-5-6(12-4-2)7(9)8(10)11/h3-5,12H,2,9H2,1H3,(H3,10,11)/b5-3-,7-6- |
| InChIKey | SOLGOIPJSIKRGH-VKLRWAGZSA-N |
| XLogP | 0.40 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide?
The IUPAC name of (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide (CID 137123519) is (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide.
What is the SMILES notation for (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide?
The canonical SMILES for (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide is [H]/N=C(N)/C(N)=C(\C=C/C)NC=C.
What is the InChIKey of (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide?
The InChIKey is SOLGOIPJSIKRGH-VKLRWAGZSA-N. The full InChI is InChI=1S/C8H14N4/c1-3-5-6(12-4-2)7(9)8(10)11/h3-5,12H,2,9H2,1H3,(H3,10,11)/b5-3-,7-6-.
What are the key properties of (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide?
(2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide has a molecular weight of 166.23 g/mol, XLogP of 0.40, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-amino-3-(ethenylamino)hexa-2,4-dienimidamide is sourced from PubChem (CID 137123519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).