About 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol
4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol (PubChem CID 137123714) has the molecular formula C20H15Cl2N3O
and a molecular weight of 384.27 g/mol. Its IUPAC name is 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol.
Molecular Properties
| Compound Name | 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol |
| PubChem CID | 137123714 |
| Molecular Formula | C20H15Cl2N3O |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol |
| SMILES | Nc1n[nH]c2cc(-c3ccc(O)cc3)c(Cc3c(Cl)cccc3Cl)cc12 |
| InChI | InChI=1S/C20H15Cl2N3O/c21-17-2-1-3-18(22)15(17)8-12-9-16-19(24-25-20(16)23)10-14(12)11-4-6-13(26)7-5-11/h1-7,9-10,26H,8H2,(H3,23,24,25) |
| InChIKey | JPFBRSYTQHMCCM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol?
The IUPAC name of 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol (CID 137123714) is 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol.
What is the SMILES notation for 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol?
The canonical SMILES for 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol is Nc1n[nH]c2cc(-c3ccc(O)cc3)c(Cc3c(Cl)cccc3Cl)cc12.
What is the InChIKey of 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol?
The InChIKey is JPFBRSYTQHMCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N3O/c21-17-2-1-3-18(22)15(17)8-12-9-16-19(24-25-20(16)23)10-14(12)11-4-6-13(26)7-5-11/h1-7,9-10,26H,8H2,(H3,23,24,25).
What are the key properties of 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol?
4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol has a molecular weight of 384.27 g/mol, XLogP of 5.42, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-amino-5-[(2,6-dichlorophenyl)methyl]-1H-indazol-6-yl]phenol is sourced from PubChem (CID 137123714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).