About 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide
3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide (PubChem CID 137123778) has the molecular formula C19H12ClF3N4O2
and a molecular weight of 420.78 g/mol. Its IUPAC name is 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide.
Molecular Properties
| Compound Name | 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide |
| PubChem CID | 137123778 |
| Molecular Formula | C19H12ClF3N4O2 |
| Molecular Weight | 420.78 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide |
| SMILES | [H]/N=C(\c1cc(F)cc(C(N)=O)c1)c1c(Nc2c(F)cccc2F)c(Cl)c[nH]c1=O |
| InChI | InChI=1S/C19H12ClF3N4O2/c20-11-7-26-19(29)14(16(11)27-17-12(22)2-1-3-13(17)23)15(24)8-4-9(18(25)28)6-10(21)5-8/h1-7,24H,(H2,25,28)(H2,26,27,29)/b24-15+ |
| InChIKey | ILCIWXYVHYWUOF-BUVRLJJBSA-N |
| XLogP | 3.70 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide?
The IUPAC name of 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide (CID 137123778) is 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide.
What is the SMILES notation for 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide?
The canonical SMILES for 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide is [H]/N=C(\c1cc(F)cc(C(N)=O)c1)c1c(Nc2c(F)cccc2F)c(Cl)c[nH]c1=O.
What is the InChIKey of 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide?
The InChIKey is ILCIWXYVHYWUOF-BUVRLJJBSA-N. The full InChI is InChI=1S/C19H12ClF3N4O2/c20-11-7-26-19(29)14(16(11)27-17-12(22)2-1-3-13(17)23)15(24)8-4-9(18(25)28)6-10(21)5-8/h1-7,24H,(H2,25,28)(H2,26,27,29)/b24-15+.
What are the key properties of 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide?
3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide has a molecular weight of 420.78 g/mol, XLogP of 3.70, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-chloro-4-(2,6-difluoroanilino)-2-oxo-1H-pyridine-3-carboximidoyl]-5-fluorobenzamide is sourced from PubChem (CID 137123778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).