C18H14N6O4S2 — CID 137125230
4-[[5-[[2-(1H-benzimidazol-2-ylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid (PubChem CID 137125230) has the molecular formula C18H14N6O4S2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 4-[[5-[[2-(1H-benzimidazol-2-ylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[5-[[2-(1H-benzimidazol-2-ylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 137125230 |
| Molecular Formula | C18H14N6O4S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 4-[[5-[[2-(1H-benzimidazol-2-ylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ncc(C=C2SC(=Nc3nc4ccccc4[nH]3)NC2=O)s1 |
| InChI | InChI=1S/C18H14N6O4S2/c25-13(5-6-14(26)27)22-17-19-8-9(29-17)7-12-15(28)23-18(30-12)24-16-20-10-3-1-2-4-11(10)21-16/h1-4,7-8H,5-6H2,(H,26,27)(H,19,22,25)(H2,20,21,23,24,28) |
| InChIKey | ZCMNTZUGJGPIFU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|