About 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine
3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine (PubChem CID 137125256) has the molecular formula C18H18F2N4
and a molecular weight of 328.37 g/mol. Its IUPAC name is 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine |
| PubChem CID | 137125256 |
| Molecular Formula | C18H18F2N4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine |
| SMILES | CN1CCN(C2=Nc3cc(F)ccc3Nc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C18H18F2N4/c1-23-6-8-24(9-7-23)18-14-10-12(19)2-4-15(14)21-16-5-3-13(20)11-17(16)22-18/h2-5,10-11,21H,6-9H2,1H3 |
| InChIKey | PYSIAKZWZJNMNM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine?
The IUPAC name of 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine (CID 137125256) is 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine.
What is the SMILES notation for 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine?
The canonical SMILES for 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine is CN1CCN(C2=Nc3cc(F)ccc3Nc3ccc(F)cc32)CC1.
What is the InChIKey of 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine?
The InChIKey is PYSIAKZWZJNMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N4/c1-23-6-8-24(9-7-23)18-14-10-12(19)2-4-15(14)21-16-5-3-13(20)11-17(16)22-18/h2-5,10-11,21H,6-9H2,1H3.
What are the key properties of 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine?
3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine has a molecular weight of 328.37 g/mol, XLogP of 3.35, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-difluoro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine is sourced from PubChem (CID 137125256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).