C12H9N3O3 — CID 137126327
5-methyl-3-phenyl-7H-[1,2]oxazolo[3,4-d]pyrimidine-4,6-dione (PubChem CID 137126327) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 5-methyl-3-phenyl-7H-[1,2]oxazolo[3,4-d]pyrimidine-4,6-dione.
| Compound Name | 5-methyl-3-phenyl-7H-[1,2]oxazolo[3,4-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 137126327 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 5-methyl-3-phenyl-7H-[1,2]oxazolo[3,4-d]pyrimidine-4,6-dione |
| SMILES | Cn1c(=O)[nH]c2noc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C12H9N3O3/c1-15-11(16)8-9(7-5-3-2-4-6-7)18-14-10(8)13-12(15)17/h2-6H,1H3,(H,13,14,17) |
| InChIKey | LMAHGSFFQCNMJI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |