About 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide
6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide (PubChem CID 137127099) has the molecular formula C15H15ClN6O
and a molecular weight of 330.78 g/mol. Its IUPAC name is 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide.
Molecular Properties
| Compound Name | 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide |
| PubChem CID | 137127099 |
| Molecular Formula | C15H15ClN6O |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=N/N=C(N)c1cc(-c2ccc(C3(OC)CC3)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C15H15ClN6O/c1-23-15(4-5-15)10-3-2-9(6-11(10)16)12-7-13(20-8-19-12)14(17)21-22-18/h2-3,6-8H,4-5H2,1H3,(H3,17,18,21) |
| InChIKey | XWXKOWIKESJKRT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide?
The IUPAC name of 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide (CID 137127099) is 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide.
What is the SMILES notation for 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide?
The canonical SMILES for 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide is [H]/N=N/N=C(N)c1cc(-c2ccc(C3(OC)CC3)c(Cl)c2)ncn1.
What is the InChIKey of 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide?
The InChIKey is XWXKOWIKESJKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN6O/c1-23-15(4-5-15)10-3-2-9(6-11(10)16)12-7-13(20-8-19-12)14(17)21-22-18/h2-3,6-8H,4-5H2,1H3,(H3,17,18,21).
What are the key properties of 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide?
6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide has a molecular weight of 330.78 g/mol, XLogP of 3.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-chloro-4-(1-methoxycyclopropyl)phenyl]-N'-diazenylpyrimidine-4-carboximidamide is sourced from PubChem (CID 137127099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).