C17H20N2O3 — CID 137127643
(3Z,5Z)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-methylidenenona-3,5-dienamide (PubChem CID 137127643) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3Z,5Z)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-methylidenenona-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-methylidenenona-3,5-dienamide |
|---|---|
| PubChem CID | 137127643 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3Z,5Z)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-methylidenenona-3,5-dienamide |
| SMILES | C=C(/C=C\C=C/CCC)C(=O)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C17H20N2O3/c1-3-4-5-6-7-8-13(2)17(22)19-18-12-14-9-10-15(20)11-16(14)21/h5-12,20-21H,2-4H2,1H3,(H,19,22)/b6-5-,8-7-,18-12+ |
| InChIKey | VCTHTWODIRRUNV-JGMWIEGYSA-N |
| XLogP | 3.02 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|