C25H28N4O2 — CID 137127814
(15Z)-21-ethyl-17-(hydroxymethyl)-24-methyl-7,11,18,23-tetrazapentacyclo[17.3.2.16,9.05,22.08,13]pentacosa-1,3,5(22),6(25),8,15,18,20-octaen-10-one (PubChem CID 137127814) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is (15Z)-21-ethyl-17-(hydroxymethyl)-24-methyl-7,11,18,23-tetrazapentacyclo[17.3.2.16,9.05,22.08,13]pentacosa-1,3,5(22),6(25),8,15,18,20-octaen-10-one.
| Compound Name | (15Z)-21-ethyl-17-(hydroxymethyl)-24-methyl-7,11,18,23-tetrazapentacyclo[17.3.2.16,9.05,22.08,13]pentacosa-1,3,5(22),6(25),8,15,18,20-octaen-10-one |
|---|---|
| PubChem CID | 137127814 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (15Z)-21-ethyl-17-(hydroxymethyl)-24-methyl-7,11,18,23-tetrazapentacyclo[17.3.2.16,9.05,22.08,13]pentacosa-1,3,5(22),6(25),8,15,18,20-octaen-10-one |
| SMILES | CCC1=C/C2=N\C(CO)/C=C\CC3CNC(=O)c4cc([nH]c43)-c3cccc(c31)NC2C |
| InChI | InChI=1S/C25H28N4O2/c1-3-15-10-21-14(2)27-20-9-5-8-18(23(15)20)22-11-19-24(29-22)16(12-26-25(19)31)6-4-7-17(13-30)28-21/h4-5,7-11,14,16-17,27,29-30H,3,6,12-13H2,1-2H3,(H,26,31)/b7-4-,28-21+ |
| InChIKey | DPFRGXMYKGCBEI-VZLQJXESSA-N |
| XLogP | 3.88 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|