C13H12F5N5O2 — CID 137128034
5-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-N-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carboxamide (PubChem CID 137128034) has the molecular formula C13H12F5N5O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 5-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-N-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carboxamide.
| Compound Name | 5-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-N-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 137128034 |
| Molecular Formula | C13H12F5N5O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 5-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-N-(2,2,3,3,3-pentafluoropropyl)pyrazole-4-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(-n2ncc(C(=O)NCC(F)(F)C(F)(F)F)c2C)n1 |
| InChI | InChI=1S/C13H12F5N5O2/c1-6-3-9(24)22-11(21-6)23-7(2)8(4-20-23)10(25)19-5-12(14,15)13(16,17)18/h3-4H,5H2,1-2H3,(H,19,25)(H,21,22,24) |
| InChIKey | MKSQCXIKBDRCPZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|