C11H8ClN5O2 — CID 137128054
5-methyl-1-(4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl)pyrazole-4-carbonyl chloride (PubChem CID 137128054) has the molecular formula C11H8ClN5O2 and a molecular weight of 277.67 g/mol. Its IUPAC name is 5-methyl-1-(4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl)pyrazole-4-carbonyl chloride.
| Compound Name | 5-methyl-1-(4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl)pyrazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 137128054 |
| Molecular Formula | C11H8ClN5O2 |
| Molecular Weight | 277.67 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 5-methyl-1-(4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl)pyrazole-4-carbonyl chloride |
| SMILES | Cc1c(C(=O)Cl)cnn1-c1nn2cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H8ClN5O2/c1-6-7(9(12)18)5-13-17(6)11-14-10(19)8-3-2-4-16(8)15-11/h2-5H,1H3,(H,14,15,19) |
| InChIKey | DOGVWJWNFJIYIO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.67 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|