C21H26F3N7O2 — CID 137128160
2-[4-[3-ethyl-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137128160) has the molecular formula C21H26F3N7O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-[4-[3-ethyl-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[4-[3-ethyl-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137128160 |
| Molecular Formula | C21H26F3N7O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[4-[3-ethyl-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CCC1CN(C(=O)c2cnn(-c3nn4cccc4c(=O)[nH]3)c2C)CC(C)CN1CC(F)(F)F |
| InChI | InChI=1S/C21H26F3N7O2/c1-4-15-11-28(9-13(2)10-29(15)12-21(22,23)24)19(33)16-8-25-31(14(16)3)20-26-18(32)17-6-5-7-30(17)27-20/h5-8,13,15H,4,9-12H2,1-3H3,(H,26,27,32) |
| InChIKey | BKJTYZJBIDSVSN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |