C29H45N7O4S — CID 137128380
N,N-bis(3-amino-2-ethylhexyl)-2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide (PubChem CID 137128380) has the molecular formula C29H45N7O4S and a molecular weight of 587.79 g/mol. Its IUPAC name is N,N-bis(3-amino-2-ethylhexyl)-2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide.
| Compound Name | N,N-bis(3-amino-2-ethylhexyl)-2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 137128380 |
| Molecular Formula | C29H45N7O4S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | N,N-bis(3-amino-2-ethylhexyl)-2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide |
| SMILES | CCCC(N)C(CC)CN(CC(CC)C(N)CCC)S(=O)(=O)c1ccccc1/N=N/c1c(C)c(C#N)c(O)[nH]c1=O |
| InChI | InChI=1S/C29H45N7O4S/c1-6-12-23(31)20(8-3)17-36(18-21(9-4)24(32)13-7-2)41(39,40)26-15-11-10-14-25(26)34-35-27-19(5)22(16-30)28(37)33-29(27)38/h10-11,14-15,20-21,23-24H,6-9,12-13,17-18,31-32H2,1-5H3,(H2,33,37,38)/b35-34+ |
| InChIKey | XYJIAKASZHEVEX-XAHDOWKMSA-N |
| XLogP | 4.97 |
| TPSA | 191.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|