C21H18F3N5O2S — CID 137128639
5-hydroxy-4-[4-[1-methyl-2-(trifluoromethyl)benzimidazol-5-yl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-propan-2-ylbenzaldehyde (PubChem CID 137128639) has the molecular formula C21H18F3N5O2S and a molecular weight of 461.47 g/mol. Its IUPAC name is 5-hydroxy-4-[4-[1-methyl-2-(trifluoromethyl)benzimidazol-5-yl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-propan-2-ylbenzaldehyde.
| Compound Name | 5-hydroxy-4-[4-[1-methyl-2-(trifluoromethyl)benzimidazol-5-yl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-propan-2-ylbenzaldehyde |
|---|---|
| PubChem CID | 137128639 |
| Molecular Formula | C21H18F3N5O2S |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 5-hydroxy-4-[4-[1-methyl-2-(trifluoromethyl)benzimidazol-5-yl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-propan-2-ylbenzaldehyde |
| SMILES | CC(C)c1cc(-c2n[nH]c(=S)n2-c2ccc3c(c2)nc(C(F)(F)F)n3C)c(O)cc1C=O |
| InChI | InChI=1S/C21H18F3N5O2S/c1-10(2)13-8-14(17(31)6-11(13)9-30)18-26-27-20(32)29(18)12-4-5-16-15(7-12)25-19(28(16)3)21(22,23)24/h4-10,31H,1-3H3,(H,27,32) |
| InChIKey | MNSVXFSLPWULJS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|