C36H54N6O4S — CID 137128861
N-[5-[[4-[bis(2-ethylhexyl)sulfinamoyl]phenyl]diazenyl]-3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]-N,2,2-trimethylbut-3-enamide (PubChem CID 137128861) has the molecular formula C36H54N6O4S and a molecular weight of 666.93 g/mol. Its IUPAC name is N-[5-[[4-[bis(2-ethylhexyl)sulfinamoyl]phenyl]diazenyl]-3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]-N,2,2-trimethylbut-3-enamide.
| Compound Name | N-[5-[[4-[bis(2-ethylhexyl)sulfinamoyl]phenyl]diazenyl]-3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]-N,2,2-trimethylbut-3-enamide |
|---|---|
| PubChem CID | 137128861 |
| Molecular Formula | C36H54N6O4S |
| Molecular Weight | 666.93 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | N-[5-[[4-[bis(2-ethylhexyl)sulfinamoyl]phenyl]diazenyl]-3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]-N,2,2-trimethylbut-3-enamide |
| SMILES | C=CC(C)(C)C(=O)N(C)n1c(O)c(C#N)c(C)c(/N=N/c2ccc(S(=O)N(CC(CC)CCCC)CC(CC)CCCC)cc2)c1=O |
| InChI | InChI=1S/C36H54N6O4S/c1-10-15-17-27(12-3)24-41(25-28(13-4)18-16-11-2)47(46)30-21-19-29(20-22-30)38-39-32-26(6)31(23-37)33(43)42(34(32)44)40(9)35(45)36(7,8)14-5/h14,19-22,27-28,43H,5,10-13,15-18,24-25H2,1-4,6-9H3/b39-38+ |
| InChIKey | KQEACDDYSBFUGV-YMZYAJTMSA-N |
| XLogP | 8.21 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.93 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|