C16H16Cl2FN3O2 — CID 137128905
4-(1-amino-1-fluoro-2-methylprop-2-enyl)-5-[(3,4-dichlorophenyl)methyl]-2-(hydroxymethyl)-1H-pyrimidin-6-one (PubChem CID 137128905) has the molecular formula C16H16Cl2FN3O2 and a molecular weight of 372.23 g/mol. Its IUPAC name is 4-(1-amino-1-fluoro-2-methylprop-2-enyl)-5-[(3,4-dichlorophenyl)methyl]-2-(hydroxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(1-amino-1-fluoro-2-methylprop-2-enyl)-5-[(3,4-dichlorophenyl)methyl]-2-(hydroxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137128905 |
| Molecular Formula | C16H16Cl2FN3O2 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-(1-amino-1-fluoro-2-methylprop-2-enyl)-5-[(3,4-dichlorophenyl)methyl]-2-(hydroxymethyl)-1H-pyrimidin-6-one |
| SMILES | C=C(C)C(N)(F)c1nc(CO)[nH]c(=O)c1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2FN3O2/c1-8(2)16(19,20)14-10(15(24)22-13(7-23)21-14)5-9-3-4-11(17)12(18)6-9/h3-4,6,23H,1,5,7,20H2,2H3,(H,21,22,24) |
| InChIKey | IWXQKAOPWUPPEA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|