C20H13BrClN3O2S — CID 137129084
5-[(5-bromoindol-3-ylidene)methyl]-1-(3-chloro-4-methylphenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 137129084) has the molecular formula C20H13BrClN3O2S and a molecular weight of 474.77 g/mol. Its IUPAC name is 5-[(5-bromoindol-3-ylidene)methyl]-1-(3-chloro-4-methylphenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(5-bromoindol-3-ylidene)methyl]-1-(3-chloro-4-methylphenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 137129084 |
| Molecular Formula | C20H13BrClN3O2S |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 5-[(5-bromoindol-3-ylidene)methyl]-1-(3-chloro-4-methylphenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1ccc(-n2c(O)c(C=C3C=Nc4ccc(Br)cc43)c(=O)[nH]c2=S)cc1Cl |
| InChI | InChI=1S/C20H13BrClN3O2S/c1-10-2-4-13(8-16(10)22)25-19(27)15(18(26)24-20(25)28)6-11-9-23-17-5-3-12(21)7-14(11)17/h2-9,27H,1H3,(H,24,26,28) |
| InChIKey | LBURBEIBBJGEQJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|