C24H26N4O9 — CID 137129735
2-[[5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl N-tert-butyl-N-methylcarbamate (PubChem CID 137129735) has the molecular formula C24H26N4O9 and a molecular weight of 514.49 g/mol. Its IUPAC name is 2-[[5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl N-tert-butyl-N-methylcarbamate.
| Compound Name | 2-[[5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl N-tert-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 137129735 |
| Molecular Formula | C24H26N4O9 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-[[5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-1,2-oxazole-3-carbonyl]amino]ethyl N-tert-butyl-N-methylcarbamate |
| SMILES | CN(C(=O)OCCNC(=O)c1cc(-c2c(O)cc(O)cc2Oc2ccc([N+](=O)[O-])cc2)on1)C(C)(C)C |
| InChI | InChI=1S/C24H26N4O9/c1-24(2,3)27(4)23(32)35-10-9-25-22(31)17-13-20(37-26-17)21-18(30)11-15(29)12-19(21)36-16-7-5-14(6-8-16)28(33)34/h5-8,11-13,29-30H,9-10H2,1-4H3,(H,25,31) |
| InChIKey | ZLNZWMPYIKCVHT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 177.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|