About acridine-3,9-diamine
acridine-3,9-diamine (PubChem CID 13713) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is acridine-3,9-diamine.
Molecular Properties
| Compound Name | acridine-3,9-diamine |
| PubChem CID | 13713 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | acridine-3,9-diamine |
| SMILES | Nc1ccc2c(N)c3ccccc3nc2c1 |
| InChI | InChI=1S/C13H11N3/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15/h1-7H,14H2,(H2,15,16) |
| InChIKey | AMOPBNMABDFREG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine-3,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine-3,9-diamine?
The IUPAC name of acridine-3,9-diamine (CID 13713) is acridine-3,9-diamine.
What is the SMILES notation for acridine-3,9-diamine?
The canonical SMILES for acridine-3,9-diamine is Nc1ccc2c(N)c3ccccc3nc2c1.
What is the InChIKey of acridine-3,9-diamine?
The InChIKey is AMOPBNMABDFREG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15/h1-7H,14H2,(H2,15,16).
What are the key properties of acridine-3,9-diamine?
acridine-3,9-diamine has a molecular weight of 209.25 g/mol, XLogP of 2.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridine-3,9-diamine is sourced from PubChem (CID 13713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).