C23H22IN3O5S — CID 137131124
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 137131124) has the molecular formula C23H22IN3O5S and a molecular weight of 579.42 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137131124 |
| Molecular Formula | C23H22IN3O5S |
| Molecular Weight | 579.42 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CN(c2ccc(I)cc2)S(=O)(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C23H22IN3O5S/c1-2-32-22-14-17(8-13-21(22)28)15-25-26-23(29)16-27(19-11-9-18(24)10-12-19)33(30,31)20-6-4-3-5-7-20/h3-15,28H,2,16H2,1H3,(H,26,29)/b25-15- |
| InChIKey | NZYYADTVKOXGBG-MYYYXRDXSA-N |
| XLogP | 3.74 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|