C24H18Br2N2O2S — CID 137131347
(5Z)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137131347) has the molecular formula C24H18Br2N2O2S and a molecular weight of 558.30 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137131347 |
| Molecular Formula | C24H18Br2N2O2S |
| Molecular Weight | 558.30 g/mol |
| Exact Mass | 555.95 |
| IUPAC Name | (5Z)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/N=C2\NC(=O)/C(=C/c3ccc(OCc4ccc(Br)cc4Br)cc3)S2)c1 |
| InChI | InChI=1S/C24H18Br2N2O2S/c1-15-3-2-4-19(11-15)27-24-28-23(29)22(31-24)12-16-5-9-20(10-6-16)30-14-17-7-8-18(25)13-21(17)26/h2-13H,14H2,1H3,(H,27,28,29)/b22-12- |
| InChIKey | LKQPSJFBISNUGO-UUYOSTAYSA-N |
| XLogP | 6.99 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.30 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|