About 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride
5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride (PubChem CID 137131920) has the molecular formula C12H17ClN4O
and a molecular weight of 268.75 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride |
| PubChem CID | 137131920 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CC(C)(C)C(c2ccccc2O)=N1 |
| InChI | InChI=1S/C12H16N4O.ClH/c1-12(2)7-16(11(13)14)15-10(12)8-5-3-4-6-9(8)17;/h3-6,17H,7H2,1-2H3,(H3,13,14);1H |
| InChIKey | RMJIVAQSCWMIKH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride?
The IUPAC name of 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride (CID 137131920) is 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride.
What is the SMILES notation for 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride?
The canonical SMILES for 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)N1CC(C)(C)C(c2ccccc2O)=N1.
What is the InChIKey of 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride?
The InChIKey is RMJIVAQSCWMIKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O.ClH/c1-12(2)7-16(11(13)14)15-10(12)8-5-3-4-6-9(8)17;/h3-6,17H,7H2,1-2H3,(H3,13,14);1H.
What are the key properties of 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride?
5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride has a molecular weight of 268.75 g/mol, XLogP of 1.75, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyphenyl)-4,4-dimethyl-3H-pyrazole-2-carboximidamide;hydrochloride is sourced from PubChem (CID 137131920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).