C6H8IN3 — CID 137131950
3-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 137131950) has the molecular formula C6H8IN3 and a molecular weight of 249.05 g/mol. Its IUPAC name is 3-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 137131950 |
| Molecular Formula | C6H8IN3 |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 3-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | Ic1cnn2c1NCCC2 |
| InChI | InChI=1S/C6H8IN3/c7-5-4-9-10-3-1-2-8-6(5)10/h4,8H,1-3H2 |
| InChIKey | VBPMBLKWANECPJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|