About 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol
4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol (PubChem CID 137133304) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol.
Molecular Properties
| Compound Name | 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol |
| PubChem CID | 137133304 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol |
| SMILES | COc1cc(O)ccc1-c1nc2cc(CO)ccc2o1 |
| InChI | InChI=1S/C15H13NO4/c1-19-14-7-10(18)3-4-11(14)15-16-12-6-9(8-17)2-5-13(12)20-15/h2-7,17-18H,8H2,1H3 |
| InChIKey | FMKKXSLFSSVDCS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol?
The IUPAC name of 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol (CID 137133304) is 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol.
What is the SMILES notation for 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol?
The canonical SMILES for 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol is COc1cc(O)ccc1-c1nc2cc(CO)ccc2o1.
What is the InChIKey of 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol?
The InChIKey is FMKKXSLFSSVDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c1-19-14-7-10(18)3-4-11(14)15-16-12-6-9(8-17)2-5-13(12)20-15/h2-7,17-18H,8H2,1H3.
What are the key properties of 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol?
4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol has a molecular weight of 271.27 g/mol, XLogP of 2.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol is sourced from PubChem (CID 137133304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).