About 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol
2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol (PubChem CID 137133390) has the molecular formula C24H17NO3
and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol.
Molecular Properties
| Compound Name | 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol |
| PubChem CID | 137133390 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol |
| SMILES | Oc1cccc(-c2cc(-c3ccccc3O)c3c(n2)-c2ccccc2OC3)c1 |
| InChI | InChI=1S/C24H17NO3/c26-16-7-5-6-15(12-16)21-13-19(17-8-1-3-10-22(17)27)20-14-28-23-11-4-2-9-18(23)24(20)25-21/h1-13,26-27H,14H2 |
| InChIKey | PDRQNRMQAVJPKA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol?
The IUPAC name of 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol (CID 137133390) is 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol.
What is the SMILES notation for 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol?
The canonical SMILES for 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol is Oc1cccc(-c2cc(-c3ccccc3O)c3c(n2)-c2ccccc2OC3)c1.
What is the InChIKey of 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol?
The InChIKey is PDRQNRMQAVJPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17NO3/c26-16-7-5-6-15(12-16)21-13-19(17-8-1-3-10-22(17)27)20-14-28-23-11-4-2-9-18(23)24(20)25-21/h1-13,26-27H,14H2.
What are the key properties of 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol?
2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol has a molecular weight of 367.40 g/mol, XLogP of 5.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol is sourced from PubChem (CID 137133390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).