C22H15NO2S — CID 137133403
4-(2-thiophen-2-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol (PubChem CID 137133403) has the molecular formula C22H15NO2S and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-(2-thiophen-2-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol.
| Compound Name | 4-(2-thiophen-2-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol |
|---|---|
| PubChem CID | 137133403 |
| Molecular Formula | C22H15NO2S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 4-(2-thiophen-2-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol |
| SMILES | Oc1ccc(-c2cc(-c3cccs3)nc3c2COc2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H15NO2S/c24-15-9-7-14(8-10-15)17-12-19(21-6-3-11-26-21)23-22-16-4-1-2-5-20(16)25-13-18(17)22/h1-12,24H,13H2 |
| InChIKey | HUQFWWKSTIOQCJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |