About 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid
6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid (PubChem CID 137133766) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid |
| PubChem CID | 137133766 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid |
| SMILES | NC(=NO)c1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C7H7N3O3/c8-6(10-13)4-2-1-3-5(9-4)7(11)12/h1-3,13H,(H2,8,10)(H,11,12) |
| InChIKey | FAYWAXROQKFJQH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid?
The IUPAC name of 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid (CID 137133766) is 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid is NC(=NO)c1cccc(C(=O)O)n1.
What is the InChIKey of 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid?
The InChIKey is FAYWAXROQKFJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3/c8-6(10-13)4-2-1-3-5(9-4)7(11)12/h1-3,13H,(H2,8,10)(H,11,12).
What are the key properties of 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid?
6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid has a molecular weight of 181.15 g/mol, XLogP of -0.13, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(N'-hydroxycarbamimidoyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 137133766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).