C24H21N3O2 — CID 137136041
4-[2,6-bis(4-aminophenyl)-4-pyridinyl]-2-methoxyphenol (PubChem CID 137136041) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[2,6-bis(4-aminophenyl)-4-pyridinyl]-2-methoxyphenol.
| Compound Name | 4-[2,6-bis(4-aminophenyl)-4-pyridinyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 137136041 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-[2,6-bis(4-aminophenyl)-4-pyridinyl]-2-methoxyphenol |
| SMILES | COc1cc(-c2cc(-c3ccc(N)cc3)nc(-c3ccc(N)cc3)c2)ccc1O |
| InChI | InChI=1S/C24H21N3O2/c1-29-24-14-17(6-11-23(24)28)18-12-21(15-2-7-19(25)8-3-15)27-22(13-18)16-4-9-20(26)10-5-16/h2-14,28H,25-26H2,1H3 |
| InChIKey | FOGUFJHFAZZMAX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|