About 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine
4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 137136360) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| PubChem CID | 137136360 |
| Molecular Formula | C5H7N5 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | NC1=NCc2cn[nH]c2N1 |
| InChI | InChI=1S/C5H7N5/c6-5-7-1-3-2-8-10-4(3)9-5/h2H,1H2,(H4,6,7,8,9,10) |
| InChIKey | BJZZYKHTOGERSA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine (CID 137136360) is 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
What is the SMILES notation for 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The canonical SMILES for 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine is NC1=NCc2cn[nH]c2N1.
What is the InChIKey of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The InChIKey is BJZZYKHTOGERSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5/c6-5-7-1-3-2-8-10-4(3)9-5/h2H,1H2,(H4,6,7,8,9,10).
What are the key properties of 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine has a molecular weight of 137.15 g/mol, XLogP of -0.35, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-1H-pyrazolo[5,4-d]pyrimidin-6-amine is sourced from PubChem (CID 137136360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).