C24H27N7O2 — CID 137137580
2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one (PubChem CID 137137580) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137137580 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one |
| SMILES | [H]/N=C/C=N\Nc1ccccc1C(=O)N1CCN(c2nc3cccc(C)c3c(=O)[nH]2)CCC1C |
| InChI | InChI=1S/C24H27N7O2/c1-16-6-5-9-20-21(16)22(32)28-24(27-20)30-13-10-17(2)31(15-14-30)23(33)18-7-3-4-8-19(18)29-26-12-11-25/h3-9,11-12,17,25,29H,10,13-15H2,1-2H3,(H,27,28,32)/b25-11+,26-12- |
| InChIKey | ZHPPKXDIXSYQNR-OEKTYVHZSA-N |
| XLogP | 3.02 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|