About ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate
ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 137137692) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
| PubChem CID | 137137692 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1N=Cc2c1c(O)n(Cc1ccccc1)c2O |
| InChI | InChI=1S/C16H16N2O4/c1-2-22-16(21)13-12-11(8-17-13)14(19)18(15(12)20)9-10-6-4-3-5-7-10/h3-8,13,19-20H,2,9H2,1H3 |
| InChIKey | LVLZIVHXHSRDGY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate?
The IUPAC name of ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate (CID 137137692) is ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate.
What is the SMILES notation for ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate?
The canonical SMILES for ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate is CCOC(=O)C1N=Cc2c1c(O)n(Cc1ccccc1)c2O.
What is the InChIKey of ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate?
The InChIKey is LVLZIVHXHSRDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4/c1-2-22-16(21)13-12-11(8-17-13)14(19)18(15(12)20)9-10-6-4-3-5-7-10/h3-8,13,19-20H,2,9H2,1H3.
What are the key properties of ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate?
ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate has a molecular weight of 300.31 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-benzyl-4,6-dihydroxy-3H-pyrrolo[3,4-c]pyrrole-3-carboxylate is sourced from PubChem (CID 137137692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).