C18H22F2N6O2 — CID 137138384
cis-(1S,2R)-2-[1-(4,4-difluorocyclohexyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N-[(Z)-ethylideneamino]cyclobutane-1-carboxamide (PubChem CID 137138384) has the molecular formula C18H22F2N6O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is cis-(1S,2R)-2-[1-(4,4-difluorocyclohexyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N-[(Z)-ethylideneamino]cyclobutane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-[1-(4,4-difluorocyclohexyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N-[(Z)-ethylideneamino]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 137138384 |
| Molecular Formula | C18H22F2N6O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | cis-(1S,2R)-2-[1-(4,4-difluorocyclohexyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N-[(Z)-ethylideneamino]cyclobutane-1-carboxamide |
| SMILES | C/C=N\NC(=O)[C@H]1CC[C@H]1c1nc2c(cnn2C2CCC(F)(F)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H22F2N6O2/c1-2-21-25-17(28)12-4-3-11(12)14-23-15-13(16(27)24-14)9-22-26(15)10-5-7-18(19,20)8-6-10/h2,9-12H,3-8H2,1H3,(H,25,28)(H,23,24,27)/b21-2-/t11-,12+/m1/s1 |
| InChIKey | GAJQEWKVQGLWSS-WISFPASBSA-N |
| XLogP | 2.49 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|