C8H11N3O2 — CID 137138532
4-(3,3-dideuteriomorpholin-4-yl)-1H-pyrimidin-6-one (PubChem CID 137138532) has the molecular formula C8H11N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-(3,3-dideuteriomorpholin-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-(3,3-dideuteriomorpholin-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137138532 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-(3,3-dideuteriomorpholin-4-yl)-1H-pyrimidin-6-one |
| SMILES | [2H]C1([2H])COCCN1c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C8H11N3O2/c12-8-5-7(9-6-10-8)11-1-3-13-4-2-11/h5-6H,1-4H2,(H,9,10,12)/i1D2 |
| InChIKey | UTXBNBRGUYCFNT-DICFDUPASA-N |
| XLogP | -0.39 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |