C18H22N7O2+ — CID 137138731
2-[3-[5-amino-1-[(1-methylpyridin-1-ium-3-yl)methyl]pyrazol-4-yl]imino-4,6-diiminocyclohexen-1-yl]oxyethanol (PubChem CID 137138731) has the molecular formula C18H22N7O2+ and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-[3-[5-amino-1-[(1-methylpyridin-1-ium-3-yl)methyl]pyrazol-4-yl]imino-4,6-diiminocyclohexen-1-yl]oxyethanol.
| Compound Name | 2-[3-[5-amino-1-[(1-methylpyridin-1-ium-3-yl)methyl]pyrazol-4-yl]imino-4,6-diiminocyclohexen-1-yl]oxyethanol |
|---|---|
| PubChem CID | 137138731 |
| Molecular Formula | C18H22N7O2+ |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[3-[5-amino-1-[(1-methylpyridin-1-ium-3-yl)methyl]pyrazol-4-yl]imino-4,6-diiminocyclohexen-1-yl]oxyethanol |
| SMILES | [H]/N=C1\CC(=N\[H])/C(=N/c2cnn(Cc3ccc[n+](C)c3)c2N)C=C1OCCO |
| InChI | InChI=1S/C18H22N7O2/c1-24-4-2-3-12(10-24)11-25-18(21)16(9-22-25)23-15-8-17(27-6-5-26)14(20)7-13(15)19/h2-4,8-10,19-20,26H,5-7,11,21H2,1H3/q+1/b19-13+,20-14+,23-15+ |
| InChIKey | CVCHMIOWTAMVBJ-YNRRYCPISA-N |
| XLogP | 0.75 |
| TPSA | 137.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|