C18H22N5O5+ — CID 137139939
2-amino-3-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-3-ium-6-one (PubChem CID 137139939) has the molecular formula C18H22N5O5+ and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-amino-3-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-3-ium-6-one.
| Compound Name | 2-amino-3-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-3-ium-6-one |
|---|---|
| PubChem CID | 137139939 |
| Molecular Formula | C18H22N5O5+ |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-amino-3-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-3-ium-6-one |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(N)[n+](Cc3ccccc3)c21 |
| InChI | InChI=1S/C18H21N5O5/c1-27-14-13(25)11(8-24)28-17(14)23-9-20-12-15(26)21-18(19)22(16(12)23)7-10-5-3-2-4-6-10/h2-6,9,11,13-14,17,24-25H,7-8H2,1H3,(H2,19,21,26)/p+1/t11-,13-,14-,17-/m1/s1 |
| InChIKey | YJSSKYYCYKIECE-LSCFUAHRSA-O |
| XLogP | -1.09 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|